C11H8N2O3 — CID 136986506
2-(4-amino-1,2-oxazol-5-yl)-1-benzofuran-6-ol (PubChem CID 136986506) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-(4-amino-1,2-oxazol-5-yl)-1-benzofuran-6-ol.
| Compound Name | 2-(4-amino-1,2-oxazol-5-yl)-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 136986506 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(4-amino-1,2-oxazol-5-yl)-1-benzofuran-6-ol |
| SMILES | Nc1cnoc1-c1cc2ccc(O)cc2o1 |
| InChI | InChI=1S/C11H8N2O3/c12-8-5-13-16-11(8)10-3-6-1-2-7(14)4-9(6)15-10/h1-5,14H,12H2 |
| InChIKey | WRYJUEKWKLFLDO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |