C9H13F2N5O — CID 136986756
2-[2,2-difluoroethyl(methyl)amino]-N'-hydroxy-6-methylpyrimidine-4-carboximidamide (PubChem CID 136986756) has the molecular formula C9H13F2N5O and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(methyl)amino]-N'-hydroxy-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-[2,2-difluoroethyl(methyl)amino]-N'-hydroxy-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136986756 |
| Molecular Formula | C9H13F2N5O |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-[2,2-difluoroethyl(methyl)amino]-N'-hydroxy-6-methylpyrimidine-4-carboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)nc(N(C)CC(F)F)n1 |
| InChI | InChI=1S/C9H13F2N5O/c1-5-3-6(8(12)15-17)14-9(13-5)16(2)4-7(10)11/h3,7,17H,4H2,1-2H3,(H2,12,15) |
| InChIKey | AWGXYUMEWRZFPJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|