C11H7ClF2N2O — CID 136987470
2-(3-chloro-2-fluorophenyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one (PubChem CID 136987470) has the molecular formula C11H7ClF2N2O and a molecular weight of 256.64 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136987470 |
| Molecular Formula | C11H7ClF2N2O |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2cccc(Cl)c2F)[nH]c(=O)c1F |
| InChI | InChI=1S/C11H7ClF2N2O/c1-5-8(13)11(17)16-10(15-5)6-3-2-4-7(12)9(6)14/h2-4H,1H3,(H,15,16,17) |
| InChIKey | QBALTFVZHHWMPD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |