C19H16N8O2 — CID 136988244
2-[5-[4-(azidomethyl)phenyl]-4-hydroxy-2-methylpyrazol-3-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 136988244) has the molecular formula C19H16N8O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 2-[5-[4-(azidomethyl)phenyl]-4-hydroxy-2-methylpyrazol-3-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[5-[4-(azidomethyl)phenyl]-4-hydroxy-2-methylpyrazol-3-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 136988244 |
| Molecular Formula | C19H16N8O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[5-[4-(azidomethyl)phenyl]-4-hydroxy-2-methylpyrazol-3-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(CN=[N+]=[N-])cc2)c(O)c1-c1nc2ccc(C(N)=O)cc2[nH]1 |
| InChI | InChI=1S/C19H16N8O2/c1-27-16(19-23-13-7-6-12(18(20)29)8-14(13)24-19)17(28)15(25-27)11-4-2-10(3-5-11)9-22-26-21/h2-8,28H,9H2,1H3,(H2,20,29)(H,23,24) |
| InChIKey | PYTGIVPUYDCDTG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|