C13H15F4N3O3 — CID 136988484
7-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one (PubChem CID 136988484) has the molecular formula C13H15F4N3O3 and a molecular weight of 337.27 g/mol. Its IUPAC name is 7-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136988484 |
| Molecular Formula | C13H15F4N3O3 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 7-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CCc2nc[nH]c(=O)c2CC1 |
| InChI | InChI=1S/C13H15F4N3O3/c14-12(15)13(16,17)6-23-5-10(21)20-3-1-8-9(2-4-20)18-7-19-11(8)22/h7,12H,1-6H2,(H,18,19,22) |
| InChIKey | KYBAEBCCSBXDHZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|