C9H6BrFN2OS — CID 136989033
2-(3-bromothiophen-2-yl)-5-fluoro-4-methyl-1H-pyrimidin-6-one (PubChem CID 136989033) has the molecular formula C9H6BrFN2OS and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-5-fluoro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-bromothiophen-2-yl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136989033 |
| Molecular Formula | C9H6BrFN2OS |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2sccc2Br)[nH]c(=O)c1F |
| InChI | InChI=1S/C9H6BrFN2OS/c1-4-6(11)9(14)13-8(12-4)7-5(10)2-3-15-7/h2-3H,1H3,(H,12,13,14) |
| InChIKey | UIIPRWXAHOKILQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |