About 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one
4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136989493) has the molecular formula C11H19ClN4O
and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one |
| PubChem CID | 136989493 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | CC(C)CC(C)(CN)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C11H19ClN4O/c1-7(2)4-11(3,5-13)16-9-8(12)10(17)15-6-14-9/h6-7H,4-5,13H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | IULXOUYEUPPLPC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one?
The IUPAC name of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one (CID 136989493) is 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one is CC(C)CC(C)(CN)Nc1nc[nH]c(=O)c1Cl.
What is the InChIKey of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one?
The InChIKey is IULXOUYEUPPLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClN4O/c1-7(2)4-11(3,5-13)16-9-8(12)10(17)15-6-14-9/h6-7H,4-5,13H2,1-3H3,(H2,14,15,16,17).
What are the key properties of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one?
4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one has a molecular weight of 258.75 g/mol, XLogP of 1.60, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one is sourced from PubChem (CID 136989493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).