C13H17N3O2 — CID 136989780
1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)piperidine-2-carbaldehyde (PubChem CID 136989780) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)piperidine-2-carbaldehyde.
| Compound Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 136989780 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C13H17N3O2/c17-8-10-3-1-2-6-16(10)11-7-12(18)15-13(14-11)9-4-5-9/h7-10H,1-6H2,(H,14,15,18) |
| InChIKey | CGPNRCSZBVNBBB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|