C10H9N7O — CID 136990354
N'-hydroxy-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carboximidamide (PubChem CID 136990354) has the molecular formula C10H9N7O and a molecular weight of 243.23 g/mol. Its IUPAC name is N'-hydroxy-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carboximidamide.
| Compound Name | N'-hydroxy-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 136990354 |
| Molecular Formula | C10H9N7O |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N'-hydroxy-1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carboximidamide |
| SMILES | N/C(=N/O)c1cccn1-c1nccn2cnnc12 |
| InChI | InChI=1S/C10H9N7O/c11-8(15-18)7-2-1-4-17(7)9-10-14-13-6-16(10)5-3-12-9/h1-6,18H,(H2,11,15) |
| InChIKey | DCHWPGLZFMEUBK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|