C15H18N4O — CID 136990608
5-(N-ethyl-4-methylanilino)-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136990608) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-(N-ethyl-4-methylanilino)-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-(N-ethyl-4-methylanilino)-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990608 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-(N-ethyl-4-methylanilino)-N'-hydroxypyridine-2-carboximidamide |
| SMILES | CCN(c1ccc(C)cc1)c1ccc(/C(N)=N/O)nc1 |
| InChI | InChI=1S/C15H18N4O/c1-3-19(12-6-4-11(2)5-7-12)13-8-9-14(17-10-13)15(16)18-20/h4-10,20H,3H2,1-2H3,(H2,16,18) |
| InChIKey | RHJYUWOIYNTWFQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|