C16H18N4O — CID 136990684
N'-hydroxy-5-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyridine-2-carboximidamide (PubChem CID 136990684) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-hydroxy-5-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-5-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990684 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N'-hydroxy-5-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ccc(N2CCCCc3ccccc32)cn1 |
| InChI | InChI=1S/C16H18N4O/c17-16(19-21)14-9-8-13(11-18-14)20-10-4-3-6-12-5-1-2-7-15(12)20/h1-2,5,7-9,11,21H,3-4,6,10H2,(H2,17,19) |
| InChIKey | HQYPUNAQORUXSV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|