C15H22N4O2 — CID 136990715
5-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136990715) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990715 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ccc(N2CCC3(O)CCCCC3C2)cn1 |
| InChI | InChI=1S/C15H22N4O2/c16-14(18-21)13-5-4-12(9-17-13)19-8-7-15(20)6-2-1-3-11(15)10-19/h4-5,9,11,20-21H,1-3,6-8,10H2,(H2,16,18) |
| InChIKey | PASIOPBPYZGUOD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|