C9H13N3OS — CID 136990967
N'-hydroxy-5-propan-2-ylsulfanylpyridine-2-carboximidamide (PubChem CID 136990967) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is N'-hydroxy-5-propan-2-ylsulfanylpyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-5-propan-2-ylsulfanylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136990967 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N'-hydroxy-5-propan-2-ylsulfanylpyridine-2-carboximidamide |
| SMILES | CC(C)Sc1ccc(/C(N)=N/O)nc1 |
| InChI | InChI=1S/C9H13N3OS/c1-6(2)14-7-3-4-8(11-5-7)9(10)12-13/h3-6,13H,1-2H3,(H2,10,12) |
| InChIKey | GAMFNUYRPTVHGH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|