C13H24N6O6PS+ — CID 136991196
9-[(6R,7S,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(2-aminoethylsulfanyl)-2,3,7,8-tetrahydropurin-6-amine (PubChem CID 136991196) has the molecular formula C13H24N6O6PS+ and a molecular weight of 423.41 g/mol. Its IUPAC name is 9-[(6R,7S,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(2-aminoethylsulfanyl)-2,3,7,8-tetrahydropurin-6-amine.
| Compound Name | 9-[(6R,7S,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(2-aminoethylsulfanyl)-2,3,7,8-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 136991196 |
| Molecular Formula | C13H24N6O6PS+ |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 9-[(6R,7S,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(2-aminoethylsulfanyl)-2,3,7,8-tetrahydropurin-6-amine |
| SMILES | CO[C@@H]1[C@H](N2C3=C(NC2SCCN)C(N)=NCN3)OC2CO[P+](O)(O)O[C@@H]21 |
| InChI | InChI=1S/C13H24N6O6PS/c1-22-9-8-6(4-23-26(20,21)25-8)24-12(9)19-11-7(10(15)16-5-17-11)18-13(19)27-3-2-14/h6,8-9,12-13,17-18,20-21H,2-5,14H2,1H3,(H2,15,16)/q+1/t6?,8-,9-,12+,13?/m0/s1 |
| InChIKey | AVFSAZGLBJVKKQ-FRNGPWKZSA-N |
| XLogP | -2.23 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|