C11H18BrN5O5PS+ — CID 136991199
9-[(7aR)-2-hydroxy-7-methoxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-2,3,7,8-tetrahydropurin-6-amine (PubChem CID 136991199) has the molecular formula C11H18BrN5O5PS+ and a molecular weight of 443.24 g/mol. Its IUPAC name is 9-[(7aR)-2-hydroxy-7-methoxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-2,3,7,8-tetrahydropurin-6-amine.
| Compound Name | 9-[(7aR)-2-hydroxy-7-methoxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-2,3,7,8-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 136991199 |
| Molecular Formula | C11H18BrN5O5PS+ |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 9-[(7aR)-2-hydroxy-7-methoxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-2,3,7,8-tetrahydropurin-6-amine |
| SMILES | COC1C(N2C3=C(NC2Br)C(N)=NCN3)OC2CO[P+](O)(S)O[C@H]21 |
| InChI | InChI=1S/C11H18BrN5O5PS/c1-19-7-6-4(2-20-23(18,24)22-6)21-10(7)17-9-5(16-11(17)12)8(13)14-3-15-9/h4,6-7,10-11,15-16,18,24H,2-3H2,1H3,(H2,13,14)/q+1/t4?,6-,7?,10?,11?,23?/m1/s1 |
| InChIKey | FYRAYLQCOGHQRC-GFHUMIEDSA-N |
| XLogP | -0.59 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|