C16H15N5O2 — CID 136991244
6-(2-oxopiperidin-1-yl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136991244) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-(2-oxopiperidin-1-yl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-(2-oxopiperidin-1-yl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136991244 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-(2-oxopiperidin-1-yl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=C1CCCCN1c1nc2c(cnn2-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H15N5O2/c22-13-8-4-5-9-20(13)16-18-14-12(15(23)19-16)10-17-21(14)11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2,(H,18,19,23) |
| InChIKey | BMZGBGAEEKNMNA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |