C10H5F3N4O2S — CID 136991425
3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzene-1,2-diol (PubChem CID 136991425) has the molecular formula C10H5F3N4O2S and a molecular weight of 302.24 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzene-1,2-diol.
| Compound Name | 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136991425 |
| Molecular Formula | C10H5F3N4O2S |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzene-1,2-diol |
| SMILES | Oc1cccc(-c2nn3c(C(F)(F)F)nnc3s2)c1O |
| InChI | InChI=1S/C10H5F3N4O2S/c11-10(12,13)8-14-15-9-17(8)16-7(20-9)4-2-1-3-5(18)6(4)19/h1-3,18-19H |
| InChIKey | ZAHCPZUXPCGEAN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|