C12H10F2N2O3 — CID 136992010
3-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 136992010) has the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136992010 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(-c2cc(C(=O)O)[nH]n2)cc(C(F)F)c1O |
| InChI | InChI=1S/C12H10F2N2O3/c1-5-2-6(3-7(10(5)17)11(13)14)8-4-9(12(18)19)16-15-8/h2-4,11,17H,1H3,(H,15,16)(H,18,19) |
| InChIKey | OUFVSMZVDHAIDS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |