C13H25N3S — CID 136992200
N-(1,2-dimethylpiperidin-4-yl)-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136992200) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-(1,2-dimethylpiperidin-4-yl)-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(1,2-dimethylpiperidin-4-yl)-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136992200 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-(1,2-dimethylpiperidin-4-yl)-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CC1CC(/N=C2/NC(C)(C)CCS2)CCN1C |
| InChI | InChI=1S/C13H25N3S/c1-10-9-11(5-7-16(10)4)14-12-15-13(2,3)6-8-17-12/h10-11H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | OJWYMDISUGXHIS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|