C18H15F6N3O — CID 136992955
(4S,6S)-4-[2,4-difluoro-5-(2-fluoro-3-pyridinyl)phenyl]-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine (PubChem CID 136992955) has the molecular formula C18H15F6N3O and a molecular weight of 403.33 g/mol. Its IUPAC name is (4S,6S)-4-[2,4-difluoro-5-(2-fluoro-3-pyridinyl)phenyl]-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine.
| Compound Name | (4S,6S)-4-[2,4-difluoro-5-(2-fluoro-3-pyridinyl)phenyl]-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine |
|---|---|
| PubChem CID | 136992955 |
| Molecular Formula | C18H15F6N3O |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (4S,6S)-4-[2,4-difluoro-5-(2-fluoro-3-pyridinyl)phenyl]-N,4-dimethyl-6-(trifluoromethyl)-1,3-oxazinan-2-imine |
| SMILES | C/N=C1/N[C@](C)(c2cc(-c3cccnc3F)c(F)cc2F)C[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C18H15F6N3O/c1-17(8-14(18(22,23)24)28-16(25-2)27-17)11-6-10(12(19)7-13(11)20)9-4-3-5-26-15(9)21/h3-7,14H,8H2,1-2H3,(H,25,27)/t14-,17-/m0/s1 |
| InChIKey | IVMOUHVQBHCNMO-YOEHRIQHSA-N |
| XLogP | 4.31 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|