About 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide
2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide (PubChem CID 136992993) has the molecular formula C19H17NO2S
and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide.
Molecular Properties
| Compound Name | 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide |
| PubChem CID | 136992993 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide |
| SMILES | O=C1CC(c2ccccc2)CC(O)=C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H17NO2S/c21-16-11-14(13-7-3-1-4-8-13)12-17(22)18(16)19(23)20-15-9-5-2-6-10-15/h1-10,14,21H,11-12H2,(H,20,23) |
| InChIKey | NOIPATVSMZRSOK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide?
The IUPAC name of 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide (CID 136992993) is 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide.
What is the SMILES notation for 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide?
The canonical SMILES for 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide is O=C1CC(c2ccccc2)CC(O)=C1C(=S)Nc1ccccc1.
What is the InChIKey of 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide?
The InChIKey is NOIPATVSMZRSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO2S/c21-16-11-14(13-7-3-1-4-8-13)12-17(22)18(16)19(23)20-15-9-5-2-6-10-15/h1-10,14,21H,11-12H2,(H,20,23).
What are the key properties of 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide?
2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide has a molecular weight of 323.42 g/mol, XLogP of 4.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-oxo-N,4-diphenylcyclohexene-1-carbothioamide is sourced from PubChem (CID 136992993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).