C14H17N5O4 — CID 136993240
5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 136993240) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136993240 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-[2-(2-methyl-4-oxo-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)CCN(C(=O)CC1NC(=O)NC1=O)CC2 |
| InChI | InChI=1S/C14H17N5O4/c1-7-15-9-3-5-19(4-2-8(9)12(21)16-7)11(20)6-10-13(22)18-14(23)17-10/h10H,2-6H2,1H3,(H,15,16,21)(H2,17,18,22,23) |
| InChIKey | IEGCTPDZZMPYSA-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|