C12H19N3S2 — CID 136993437
N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-propan-2-yl-1,3-thiazinan-2-imine (PubChem CID 136993437) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-propan-2-yl-1,3-thiazinan-2-imine.
| Compound Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-propan-2-yl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136993437 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-propan-2-yl-1,3-thiazinan-2-imine |
| SMILES | Cc1cnc(C/N=C2/NC(C(C)C)CCS2)s1 |
| InChI | InChI=1S/C12H19N3S2/c1-8(2)10-4-5-16-12(15-10)14-7-11-13-6-9(3)17-11/h6,8,10H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | AOEOGERSSKOKHN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|