C13H23N3OS — CID 136993539
2-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-tert-butylacetamide (PubChem CID 136993539) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-tert-butylacetamide.
| Compound Name | 2-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-tert-butylacetamide |
|---|---|
| PubChem CID | 136993539 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)C/N=C1/NC2CCCC2CS1 |
| InChI | InChI=1S/C13H23N3OS/c1-13(2,3)16-11(17)7-14-12-15-10-6-4-5-9(10)8-18-12/h9-10H,4-8H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | NKOXZUSTURRHDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|