C12H16IN3O3 — CID 136993914
ethyl 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 136993914) has the molecular formula C12H16IN3O3 and a molecular weight of 377.18 g/mol. Its IUPAC name is ethyl 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 136993914 |
| Molecular Formula | C12H16IN3O3 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | ethyl 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C12H16IN3O3/c1-2-19-12(18)8-3-5-16(6-4-8)10-9(13)11(17)15-7-14-10/h7-8H,2-6H2,1H3,(H,14,15,17) |
| InChIKey | WRHLPFGRLFRJFX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|