C6HBr2N3S — CID 136994107
4,6-dibromo-5H-azirino[2,3-f][2,1,3]benzothiadiazole (PubChem CID 136994107) has the molecular formula C6HBr2N3S and a molecular weight of 306.97 g/mol. Its IUPAC name is 4,6-dibromo-5H-azirino[2,3-f][2,1,3]benzothiadiazole.
| Compound Name | 4,6-dibromo-5H-azirino[2,3-f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 136994107 |
| Molecular Formula | C6HBr2N3S |
| Molecular Weight | 306.97 g/mol |
| Exact Mass | 304.83 |
| IUPAC Name | 4,6-dibromo-5H-azirino[2,3-f][2,1,3]benzothiadiazole |
| SMILES | Brc1c2c(c(Br)c3nsnc13)N2 |
| InChI | InChI=1S/C6HBr2N3S/c7-1-3-4(9-3)2(8)6-5(1)10-12-11-6/h9H |
| InChIKey | VPMFMLTWOQQMJN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|