C14H10F3N5O2S — CID 136994824
12-(3-methylthiophen-2-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2,2,2-trifluoroacetic acid (PubChem CID 136994824) has the molecular formula C14H10F3N5O2S and a molecular weight of 369.33 g/mol. Its IUPAC name is 12-(3-methylthiophen-2-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2,2,2-trifluoroacetic acid.
| Compound Name | 12-(3-methylthiophen-2-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 136994824 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 12-(3-methylthiophen-2-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccsc1-c1nnc2cnc3[nH]ccc3n12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H9N5S.C2HF3O2/c1-7-3-5-18-10(7)12-16-15-9-6-14-11-8(17(9)12)2-4-13-11;3-2(4,5)1(6)7/h2-6,13H,1H3;(H,6,7) |
| InChIKey | XHSDMUDUGIWANT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |