C13H11F3N2O4 — CID 136995053
5-[2-hydroxy-3-methoxy-4-(trifluoromethyl)phenyl]-1-methylpyrazole-3-carboxylic acid (PubChem CID 136995053) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is 5-[2-hydroxy-3-methoxy-4-(trifluoromethyl)phenyl]-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-[2-hydroxy-3-methoxy-4-(trifluoromethyl)phenyl]-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136995053 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-[2-hydroxy-3-methoxy-4-(trifluoromethyl)phenyl]-1-methylpyrazole-3-carboxylic acid |
| SMILES | COc1c(C(F)(F)F)ccc(-c2cc(C(=O)O)nn2C)c1O |
| InChI | InChI=1S/C13H11F3N2O4/c1-18-9(5-8(17-18)12(20)21)6-3-4-7(13(14,15)16)11(22-2)10(6)19/h3-5,19H,1-2H3,(H,20,21) |
| InChIKey | WTTCRTNCQCWVBP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |