C14H16FN3O — CID 136995207
2-cyclopropylimino-5-[(4-fluorophenyl)methyl]-5-methylimidazolidin-4-one (PubChem CID 136995207) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-cyclopropylimino-5-[(4-fluorophenyl)methyl]-5-methylimidazolidin-4-one.
| Compound Name | 2-cyclopropylimino-5-[(4-fluorophenyl)methyl]-5-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 136995207 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-cyclopropylimino-5-[(4-fluorophenyl)methyl]-5-methylimidazolidin-4-one |
| SMILES | CC1(Cc2ccc(F)cc2)N/C(=N/C2CC2)NC1=O |
| InChI | InChI=1S/C14H16FN3O/c1-14(8-9-2-4-10(15)5-3-9)12(19)17-13(18-14)16-11-6-7-11/h2-5,11H,6-8H2,1H3,(H2,16,17,18,19) |
| InChIKey | NXZDVZVSPBKSQY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|