About 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine
4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine (PubChem CID 136995808) has the molecular formula C9H11BrN4
and a molecular weight of 255.12 g/mol. Its IUPAC name is 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine |
| PubChem CID | 136995808 |
| Molecular Formula | C9H11BrN4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine |
| SMILES | CN(C)c1n[nH]c(-c2cc[nH]c2)c1Br |
| InChI | InChI=1S/C9H11BrN4/c1-14(2)9-7(10)8(12-13-9)6-3-4-11-5-6/h3-5,11H,1-2H3,(H,12,13) |
| InChIKey | NGHFGRRAKVIETA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine?
The IUPAC name of 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine (CID 136995808) is 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine is CN(C)c1n[nH]c(-c2cc[nH]c2)c1Br.
What is the InChIKey of 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine?
The InChIKey is NGHFGRRAKVIETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN4/c1-14(2)9-7(10)8(12-13-9)6-3-4-11-5-6/h3-5,11H,1-2H3,(H,12,13).
What are the key properties of 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine?
4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine has a molecular weight of 255.12 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-dimethyl-5-(1H-pyrrol-3-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 136995808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).