C11H13N3 — CID 136995829
N',2-dimethyl-1H-indole-3-carboximidamide (PubChem CID 136995829) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is N',2-dimethyl-1H-indole-3-carboximidamide.
| Compound Name | N',2-dimethyl-1H-indole-3-carboximidamide |
|---|---|
| PubChem CID | 136995829 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N',2-dimethyl-1H-indole-3-carboximidamide |
| SMILES | C/N=C(\N)c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C11H13N3/c1-7-10(11(12)13-2)8-5-3-4-6-9(8)14-7/h3-6,14H,1-2H3,(H2,12,13) |
| InChIKey | RYELCLLMWVVFPC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|