C15H24N4O — CID 136995911
4-amino-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-propyl-1H-pyrimidin-6-one (PubChem CID 136995911) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-amino-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-propyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136995911 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-amino-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1c(N)nc(C2CC3CCC(C2)N3C)[nH]c1=O |
| InChI | InChI=1S/C15H24N4O/c1-3-4-12-13(16)17-14(18-15(12)20)9-7-10-5-6-11(8-9)19(10)2/h9-11H,3-8H2,1-2H3,(H3,16,17,18,20) |
| InChIKey | XEBTWUSUMWZUIW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |