C23H19ClFN9 — CID 136996837
4-[5-[(4-chloro-3-fluorophenyl)methyl]-2,3,7,12-tetrazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 136996837) has the molecular formula C23H19ClFN9 and a molecular weight of 475.92 g/mol. Its IUPAC name is 4-[5-[(4-chloro-3-fluorophenyl)methyl]-2,3,7,12-tetrazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-[5-[(4-chloro-3-fluorophenyl)methyl]-2,3,7,12-tetrazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 136996837 |
| Molecular Formula | C23H19ClFN9 |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 4-[5-[(4-chloro-3-fluorophenyl)methyl]-2,3,7,12-tetrazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(Cc2ccc(Cl)c(F)c2)CN3)n1 |
| InChI | InChI=1S/C23H19ClFN9/c1-33-19(5-7-28-33)30-23-26-6-4-18(29-23)14-10-20-27-12-15(22-32-31-21(11-14)34(20)22)8-13-2-3-16(24)17(25)9-13/h2-7,9-11,15,27H,8,12H2,1H3,(H,26,29,30) |
| InChIKey | ONTYTFWHLKAMFE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |