C15H23F3N4O2 — CID 136996870
4-hydroxy-3-[1-(methylamino)heptan-4-yl]-4-(trifluoromethyl)-5,7-dihydro-2H-pyrazolo[3,4-b]pyridin-6-one (PubChem CID 136996870) has the molecular formula C15H23F3N4O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-hydroxy-3-[1-(methylamino)heptan-4-yl]-4-(trifluoromethyl)-5,7-dihydro-2H-pyrazolo[3,4-b]pyridin-6-one.
| Compound Name | 4-hydroxy-3-[1-(methylamino)heptan-4-yl]-4-(trifluoromethyl)-5,7-dihydro-2H-pyrazolo[3,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136996870 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-hydroxy-3-[1-(methylamino)heptan-4-yl]-4-(trifluoromethyl)-5,7-dihydro-2H-pyrazolo[3,4-b]pyridin-6-one |
| SMILES | CCCC(CCCNC)c1[nH]nc2c1C(O)(C(F)(F)F)CC(=O)N2 |
| InChI | InChI=1S/C15H23F3N4O2/c1-3-5-9(6-4-7-19-2)12-11-13(22-21-12)20-10(23)8-14(11,24)15(16,17)18/h9,19,24H,3-8H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | AJWMZRHRLKLDOT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|