C10H14N2O2 — CID 136997554
2-[cyclopropyl(methoxy)methyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136997554) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-[cyclopropyl(methoxy)methyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[cyclopropyl(methoxy)methyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136997554 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[cyclopropyl(methoxy)methyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | COC(c1nc(C)cc(=O)[nH]1)C1CC1 |
| InChI | InChI=1S/C10H14N2O2/c1-6-5-8(13)12-10(11-6)9(14-2)7-3-4-7/h5,7,9H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | JRNZMWOTFGVYSU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |