C11H8BrFN2O4 — CID 136998162
5-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 136998162) has the molecular formula C11H8BrFN2O4 and a molecular weight of 331.10 g/mol. Its IUPAC name is 5-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136998162 |
| Molecular Formula | C11H8BrFN2O4 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)cc1-c1c(Br)cc(O)c(O)c1F |
| InChI | InChI=1S/C11H8BrFN2O4/c1-15-6(3-5(14-15)11(18)19)8-4(12)2-7(16)10(17)9(8)13/h2-3,16-17H,1H3,(H,18,19) |
| InChIKey | AOMMIDJUDBVODD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|