About 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide
1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide (PubChem CID 136999161) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide.
Molecular Properties
| Compound Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide |
| PubChem CID | 136999161 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide |
| SMILES | CC1(C)CCC(Cn2ccnc2/C(N)=N/O)O1 |
| InChI | InChI=1S/C11H18N4O2/c1-11(2)4-3-8(17-11)7-15-6-5-13-10(15)9(12)14-16/h5-6,8,16H,3-4,7H2,1-2H3,(H2,12,14) |
| InChIKey | QPSRPXPQKGPYAW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide?
The IUPAC name of 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide (CID 136999161) is 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide.
What is the SMILES notation for 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide?
The canonical SMILES for 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide is CC1(C)CCC(Cn2ccnc2/C(N)=N/O)O1.
What is the InChIKey of 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide?
The InChIKey is QPSRPXPQKGPYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-11(2)4-3-8(17-11)7-15-6-5-13-10(15)9(12)14-16/h5-6,8,16H,3-4,7H2,1-2H3,(H2,12,14).
What are the key properties of 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide?
1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide has a molecular weight of 238.29 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,5-dimethyloxolan-2-yl)methyl]-N'-hydroxyimidazole-2-carboximidamide is sourced from PubChem (CID 136999161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).