C26H24N6O9S — CID 136999448
(2R)-2-[[2-[4-hydroxy-3-(2-hydroxy-5-sulfamoylphenyl)-5-(6-methanehydrazonoyl-1H-benzimidazol-2-yl)phenyl]acetyl]amino]butanedioic acid (PubChem CID 136999448) has the molecular formula C26H24N6O9S and a molecular weight of 596.58 g/mol. Its IUPAC name is (2R)-2-[[2-[4-hydroxy-3-(2-hydroxy-5-sulfamoylphenyl)-5-(6-methanehydrazonoyl-1H-benzimidazol-2-yl)phenyl]acetyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[2-[4-hydroxy-3-(2-hydroxy-5-sulfamoylphenyl)-5-(6-methanehydrazonoyl-1H-benzimidazol-2-yl)phenyl]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 136999448 |
| Molecular Formula | C26H24N6O9S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | (2R)-2-[[2-[4-hydroxy-3-(2-hydroxy-5-sulfamoylphenyl)-5-(6-methanehydrazonoyl-1H-benzimidazol-2-yl)phenyl]acetyl]amino]butanedioic acid |
| SMILES | NN=Cc1ccc2nc(-c3cc(CC(=O)N[C@H](CC(=O)O)C(=O)O)cc(-c4cc(S(N)(=O)=O)ccc4O)c3O)[nH]c2c1 |
| InChI | InChI=1S/C26H24N6O9S/c27-29-11-12-1-3-18-19(7-12)32-25(31-18)17-6-13(8-22(34)30-20(26(38)39)10-23(35)36)5-16(24(17)37)15-9-14(42(28,40)41)2-4-21(15)33/h1-7,9,11,20,33,37H,8,10,27H2,(H,30,34)(H,31,32)(H,35,36)(H,38,39)(H2,28,40,41)/t20-/m1/s1 |
| InChIKey | VMABSNZLLZXNRE-HXUWFJFHSA-N |
| XLogP | 0.83 |
| TPSA | 271.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|