C16H14N4O2 — CID 136999456
4-(oxan-2-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one (PubChem CID 136999456) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(oxan-2-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one.
| Compound Name | 4-(oxan-2-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one |
|---|---|
| PubChem CID | 136999456 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-(oxan-2-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one |
| SMILES | O=c1c2cnc3[nH]ccc(c4cn(C5CCCCO5)nc14)c32 |
| InChI | InChI=1S/C16H14N4O2/c21-15-10-7-18-16-13(10)9(4-5-17-16)11-8-20(19-14(11)15)12-3-1-2-6-22-12/h4-5,7-8,12H,1-3,6H2,(H,17,18) |
| InChIKey | FWIMOOWAAAJEOQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |