About 2-octylphenol
2-octylphenol (PubChem CID 13700) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-octylphenol.
Molecular Properties
| Compound Name | 2-octylphenol |
| PubChem CID | 13700 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-octylphenol |
| SMILES | CCCCCCCCc1ccccc1O |
| InChI | InChI=1S/C14H22O/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h8-9,11-12,15H,2-7,10H2,1H3 |
| InChIKey | DUIOKRXOKLLURE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylphenol?
The IUPAC name of 2-octylphenol (CID 13700) is 2-octylphenol.
What is the SMILES notation for 2-octylphenol?
The canonical SMILES for 2-octylphenol is CCCCCCCCc1ccccc1O.
What is the InChIKey of 2-octylphenol?
The InChIKey is DUIOKRXOKLLURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h8-9,11-12,15H,2-7,10H2,1H3.
What are the key properties of 2-octylphenol?
2-octylphenol has a molecular weight of 206.33 g/mol, XLogP of 4.30, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylphenol is sourced from PubChem (CID 13700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).