C6H9F3N6O2S — CID 137000162
5-(2,2,2-trifluoroethylsulfamoylamino)-1H-pyrazole-4-carboximidamide (PubChem CID 137000162) has the molecular formula C6H9F3N6O2S and a molecular weight of 286.24 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethylsulfamoylamino)-1H-pyrazole-4-carboximidamide.
| Compound Name | 5-(2,2,2-trifluoroethylsulfamoylamino)-1H-pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 137000162 |
| Molecular Formula | C6H9F3N6O2S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-(2,2,2-trifluoroethylsulfamoylamino)-1H-pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn[nH]c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N6O2S/c7-6(8,9)2-13-18(16,17)15-5-3(4(10)11)1-12-14-5/h1,13H,2H2,(H3,10,11)(H2,12,14,15) |
| InChIKey | ABIPVDUHDXUBTM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|