About 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol
4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol (PubChem CID 137001375) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol |
| PubChem CID | 137001375 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol |
| SMILES | Oc1ccc(-c2nc3c(Nc4ccccc4)nccc3[nH]2)cc1 |
| InChI | InChI=1S/C18H14N4O/c23-14-8-6-12(7-9-14)17-21-15-10-11-19-18(16(15)22-17)20-13-4-2-1-3-5-13/h1-11,23H,(H,19,20)(H,21,22) |
| InChIKey | BQKHIJLXMOGBKY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol?
The IUPAC name of 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol (CID 137001375) is 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol.
What is the SMILES notation for 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol?
The canonical SMILES for 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol is Oc1ccc(-c2nc3c(Nc4ccccc4)nccc3[nH]2)cc1.
What is the InChIKey of 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol?
The InChIKey is BQKHIJLXMOGBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c23-14-8-6-12(7-9-14)17-21-15-10-11-19-18(16(15)22-17)20-13-4-2-1-3-5-13/h1-11,23H,(H,19,20)(H,21,22).
What are the key properties of 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol?
4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol has a molecular weight of 302.34 g/mol, XLogP of 4.07, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-anilino-1H-imidazo[4,5-c]pyridin-2-yl)phenol is sourced from PubChem (CID 137001375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).