C24H23N5O3 — CID 137002303
2-[4-(N-methyl-4-morpholin-4-ylanilino)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137002303) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[4-(N-methyl-4-morpholin-4-ylanilino)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-(N-methyl-4-morpholin-4-ylanilino)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137002303 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[4-(N-methyl-4-morpholin-4-ylanilino)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CN(c1ccc(Oc2nc3cnccc3c(=O)[nH]2)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23N5O3/c1-28(17-2-4-19(5-3-17)29-12-14-31-15-13-29)18-6-8-20(9-7-18)32-24-26-22-16-25-11-10-21(22)23(30)27-24/h2-11,16H,12-15H2,1H3,(H,26,27,30) |
| InChIKey | WLMRSZUYFSTETI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|