C11H22N4OS — CID 137002781
3-[2-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-1,1-dimethylurea (PubChem CID 137002781) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-[2-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 137002781 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[2-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-1,1-dimethylurea |
| SMILES | CC1CS/C(=N\CCNC(=O)N(C)C)NC1C |
| InChI | InChI=1S/C11H22N4OS/c1-8-7-17-10(14-9(8)2)12-5-6-13-11(16)15(3)4/h8-9H,5-7H2,1-4H3,(H,12,14)(H,13,16) |
| InChIKey | LLPGSRCZPWTITC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|