About 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol
4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol (PubChem CID 137003446) has the molecular formula C12H14BrN3O
and a molecular weight of 296.17 g/mol. Its IUPAC name is 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol |
| PubChem CID | 137003446 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(Br)c(C)c1-c1cc(N)n(C)n1 |
| InChI | InChI=1S/C12H14BrN3O/c1-6-4-9(17)12(13)7(2)11(6)8-5-10(14)16(3)15-8/h4-5,17H,14H2,1-3H3 |
| InChIKey | NGPWXZVZSNRBKN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol?
The IUPAC name of 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol (CID 137003446) is 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol.
What is the SMILES notation for 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol?
The canonical SMILES for 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol is Cc1cc(O)c(Br)c(C)c1-c1cc(N)n(C)n1.
What is the InChIKey of 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol?
The InChIKey is NGPWXZVZSNRBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3O/c1-6-4-9(17)12(13)7(2)11(6)8-5-10(14)16(3)15-8/h4-5,17H,14H2,1-3H3.
What are the key properties of 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol?
4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol has a molecular weight of 296.17 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1-methylpyrazol-3-yl)-2-bromo-3,5-dimethylphenol is sourced from PubChem (CID 137003446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).