About 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one
3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one (PubChem CID 137003780) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 137003780 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one |
| SMILES | COCCN(C)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C6H11N3O3/c1-9(3-4-11-2)5-7-6(10)12-8-5/h3-4H2,1-2H3,(H,7,8,10) |
| InChIKey | AGCRVVAMMAFFSI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one (CID 137003780) is 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one is COCCN(C)c1noc(=O)[nH]1.
What is the InChIKey of 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one?
The InChIKey is AGCRVVAMMAFFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-9(3-4-11-2)5-7-6(10)12-8-5/h3-4H2,1-2H3,(H,7,8,10).
What are the key properties of 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one?
3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one has a molecular weight of 173.17 g/mol, XLogP of -0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methoxyethyl(methyl)amino]-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 137003780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).