About 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile
2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile (PubChem CID 137003950) has the molecular formula C14H8Cl2F3N3O
and a molecular weight of 362.14 g/mol. Its IUPAC name is 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile |
| PubChem CID | 137003950 |
| Molecular Formula | C14H8Cl2F3N3O |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile |
| SMILES | N#CCc1nc(C(F)(F)F)c(Cc2ccc(Cl)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H8Cl2F3N3O/c15-9-2-1-7(6-10(9)16)5-8-12(14(17,18)19)21-11(3-4-20)22-13(8)23/h1-2,6H,3,5H2,(H,21,22,23) |
| InChIKey | RXQPVJTUEYPOGR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile?
The IUPAC name of 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile (CID 137003950) is 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile.
What is the SMILES notation for 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile?
The canonical SMILES for 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile is N#CCc1nc(C(F)(F)F)c(Cc2ccc(Cl)c(Cl)c2)c(=O)[nH]1.
What is the InChIKey of 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile?
The InChIKey is RXQPVJTUEYPOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F3N3O/c15-9-2-1-7(6-10(9)16)5-8-12(14(17,18)19)21-11(3-4-20)22-13(8)23/h1-2,6H,3,5H2,(H,21,22,23).
What are the key properties of 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile?
2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile has a molecular weight of 362.14 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetonitrile is sourced from PubChem (CID 137003950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).