C11H15N5O — CID 137004350
2,5-dimethyl-4-(3-propyltriazol-4-yl)-1H-pyrimidin-6-one (PubChem CID 137004350) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-propyltriazol-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 2,5-dimethyl-4-(3-propyltriazol-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137004350 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2,5-dimethyl-4-(3-propyltriazol-4-yl)-1H-pyrimidin-6-one |
| SMILES | CCCn1nncc1-c1nc(C)[nH]c(=O)c1C |
| InChI | InChI=1S/C11H15N5O/c1-4-5-16-9(6-12-15-16)10-7(2)11(17)14-8(3)13-10/h6H,4-5H2,1-3H3,(H,13,14,17) |
| InChIKey | PLLAEEFBCZVPRV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |