C12H13N3O2 — CID 137004647
3-(4-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-ol (PubChem CID 137004647) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-ol.
| Compound Name | 3-(4-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-ol |
|---|---|
| PubChem CID | 137004647 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-(4-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-ol |
| SMILES | Oc1ccc(-c2nnc3n2CCCC3O)cc1 |
| InChI | InChI=1S/C12H13N3O2/c16-9-5-3-8(4-6-9)11-13-14-12-10(17)2-1-7-15(11)12/h3-6,10,16-17H,1-2,7H2 |
| InChIKey | UEDBGKCTLPXYPN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |