About 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one
7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 137006022) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 137006022 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | CCc1cc2n(c(=O)n1)CCN2 |
| InChI | InChI=1S/C8H11N3O/c1-2-6-5-7-9-3-4-11(7)8(12)10-6/h5,9H,2-4H2,1H3 |
| InChIKey | WMFIJQJGPFVSKI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one (CID 137006022) is 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one is CCc1cc2n(c(=O)n1)CCN2.
What is the InChIKey of 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The InChIKey is WMFIJQJGPFVSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-2-6-5-7-9-3-4-11(7)8(12)10-6/h5,9H,2-4H2,1H3.
What are the key properties of 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one has a molecular weight of 165.20 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 137006022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).